C20H48O7Si5 — CID 523386
bis(trimethylsilyl) (2R,4R)-2,3,4-tris(trimethylsilyloxy)pentanedioate (PubChem CID 523386) has the molecular formula C20H48O7Si5 and a molecular weight of 541.03 g/mol. Its IUPAC name is bis(trimethylsilyl) (2R,4R)-2,3,4-tris(trimethylsilyloxy)pentanedioate.
| Compound Name | bis(trimethylsilyl) (2R,4R)-2,3,4-tris(trimethylsilyloxy)pentanedioate |
|---|---|
| PubChem CID | 523386 |
| Molecular Formula | C20H48O7Si5 |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | bis(trimethylsilyl) (2R,4R)-2,3,4-tris(trimethylsilyloxy)pentanedioate |
| SMILES | C[Si](C)(C)OC(=O)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C20H48O7Si5/c1-28(2,3)23-16(17(24-29(4,5)6)19(21)26-31(10,11)12)18(25-30(7,8)9)20(22)27-32(13,14)15/h16-18H,1-15H3/t17-,18-/m1/s1 |
| InChIKey | QGJKSEWJPVGCIU-QZTJIDSGSA-N |
| XLogP | 5.40 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|