About bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate
bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate (PubChem CID 523397) has the molecular formula C16H38O6Si4
and a molecular weight of 438.82 g/mol. Its IUPAC name is bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate.
Molecular Properties
| Compound Name | bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate |
| PubChem CID | 523397 |
| Molecular Formula | C16H38O6Si4 |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate |
| SMILES | C[Si](C)(C)OC(=O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H38O6Si4/c1-23(2,3)19-13(15(17)21-25(7,8)9)14(20-24(4,5)6)16(18)22-26(10,11)12/h13-14H,1-12H3/t13-,14+ |
| InChIKey | LPQBQHQEJJCWBZ-OKILXGFUSA-N |
| XLogP | 4.18 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate?
The IUPAC name of bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate (CID 523397) is bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate.
What is the SMILES notation for bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate?
The canonical SMILES for bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate is C[Si](C)(C)OC(=O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate?
The InChIKey is LPQBQHQEJJCWBZ-OKILXGFUSA-N. The full InChI is InChI=1S/C16H38O6Si4/c1-23(2,3)19-13(15(17)21-25(7,8)9)14(20-24(4,5)6)16(18)22-26(10,11)12/h13-14H,1-12H3/t13-,14+.
What are the key properties of bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate?
bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate has a molecular weight of 438.82 g/mol, XLogP of 4.18, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) (2R,3S)-2,3-bis(trimethylsilyloxy)butanedioate is sourced from PubChem (CID 523397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).