C24H58O8Si6 — CID 523400
bis(trimethylsilyl) (2R,3S,4S,5S)-2,3,4,5-tetrakis(trimethylsilyloxy)hexanedioate (PubChem CID 523400) has the molecular formula C24H58O8Si6 and a molecular weight of 643.24 g/mol. Its IUPAC name is bis(trimethylsilyl) (2R,3S,4S,5S)-2,3,4,5-tetrakis(trimethylsilyloxy)hexanedioate.
| Compound Name | bis(trimethylsilyl) (2R,3S,4S,5S)-2,3,4,5-tetrakis(trimethylsilyloxy)hexanedioate |
|---|---|
| PubChem CID | 523400 |
| Molecular Formula | C24H58O8Si6 |
| Molecular Weight | 643.24 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | bis(trimethylsilyl) (2R,3S,4S,5S)-2,3,4,5-tetrakis(trimethylsilyloxy)hexanedioate |
| SMILES | C[Si](C)(C)OC(=O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C24H58O8Si6/c1-33(2,3)27-19(21(29-35(7,8)9)23(25)31-37(13,14)15)20(28-34(4,5)6)22(30-36(10,11)12)24(26)32-38(16,17)18/h19-22H,1-18H3/t19-,20-,21-,22+/m0/s1 |
| InChIKey | AFNUGMFTFWKGLV-MYGLTJDJSA-N |
| XLogP | 6.62 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.24 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|