About N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 5234031) has the molecular formula C20H17ClFN3O4S2
and a molecular weight of 481.96 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide.
Molecular Properties
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide |
| PubChem CID | 5234031 |
| Molecular Formula | C20H17ClFN3O4S2 |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)cc2)cs1)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H17ClFN3O4S2/c21-15-4-1-13(2-5-15)17-12-30-20(23-17)24-19(26)14-3-6-16(22)18(11-14)31(27,28)25-7-9-29-10-8-25/h1-6,11-12H,7-10H2,(H,23,24,26) |
| InChIKey | LONBUIZXZKVJDG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide?
The IUPAC name of N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide (CID 5234031) is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide.
What is the SMILES notation for N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide?
The canonical SMILES for N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide is O=C(Nc1nc(-c2ccc(Cl)cc2)cs1)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1.
What is the InChIKey of N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide?
The InChIKey is LONBUIZXZKVJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClFN3O4S2/c21-15-4-1-13(2-5-15)17-12-30-20(23-17)24-19(26)14-3-6-16(22)18(11-14)31(27,28)25-7-9-29-10-8-25/h1-6,11-12H,7-10H2,(H,23,24,26).
What are the key properties of N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide?
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide has a molecular weight of 481.96 g/mol, XLogP of 3.88, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide is sourced from PubChem (CID 5234031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).