C12H15F5OSi — CID 523426
butan-2-yloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 523426) has the molecular formula C12H15F5OSi and a molecular weight of 298.33 g/mol. Its IUPAC name is butan-2-yloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | butan-2-yloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 523426 |
| Molecular Formula | C12H15F5OSi |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | butan-2-yloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | CCC(C)O[Si](C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H15F5OSi/c1-5-6(2)18-19(3,4)12-10(16)8(14)7(13)9(15)11(12)17/h6H,5H2,1-4H3 |
| InChIKey | CIZYHNJYZDXRSO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|