C16H13F5O2Si — CID 523433
[dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl] 4-methylbenzoate (PubChem CID 523433) has the molecular formula C16H13F5O2Si and a molecular weight of 360.35 g/mol. Its IUPAC name is [dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl] 4-methylbenzoate.
| Compound Name | [dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 523433 |
| Molecular Formula | C16H13F5O2Si |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [dimethyl-(2,3,4,5,6-pentafluorophenyl)silyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[Si](C)(C)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H13F5O2Si/c1-8-4-6-9(7-5-8)16(22)23-24(2,3)15-13(20)11(18)10(17)12(19)14(15)21/h4-7H,1-3H3 |
| InChIKey | SFMPOMPQTREENX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|