About decoxy(triethyl)silane
decoxy(triethyl)silane (PubChem CID 523468) has the molecular formula C16H36OSi
and a molecular weight of 272.55 g/mol. Its IUPAC name is decoxy(triethyl)silane.
Molecular Properties
| Compound Name | decoxy(triethyl)silane |
| PubChem CID | 523468 |
| Molecular Formula | C16H36OSi |
| Molecular Weight | 272.55 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | decoxy(triethyl)silane |
| SMILES | CCCCCCCCCCO[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H36OSi/c1-5-9-10-11-12-13-14-15-16-17-18(6-2,7-3)8-4/h5-16H2,1-4H3 |
| InChIKey | SHTTYXXIIRONIA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze decoxy(triethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decoxy(triethyl)silane?
The IUPAC name of decoxy(triethyl)silane (CID 523468) is decoxy(triethyl)silane.
What is the SMILES notation for decoxy(triethyl)silane?
The canonical SMILES for decoxy(triethyl)silane is CCCCCCCCCCO[Si](CC)(CC)CC.
What is the InChIKey of decoxy(triethyl)silane?
The InChIKey is SHTTYXXIIRONIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36OSi/c1-5-9-10-11-12-13-14-15-16-17-18(6-2,7-3)8-4/h5-16H2,1-4H3.
What are the key properties of decoxy(triethyl)silane?
decoxy(triethyl)silane has a molecular weight of 272.55 g/mol, XLogP of 6.15, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for decoxy(triethyl)silane is sourced from PubChem (CID 523468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).