C22H23ClN4OS — CID 5234714
N-[1-[5-[(4-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-methylbenzamide (PubChem CID 5234714) has the molecular formula C22H23ClN4OS and a molecular weight of 426.97 g/mol. Its IUPAC name is N-[1-[5-[(4-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-methylbenzamide.
| Compound Name | N-[1-[5-[(4-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 5234714 |
| Molecular Formula | C22H23ClN4OS |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-[1-[5-[(4-chlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]ethyl]-2-methylbenzamide |
| SMILES | C=CCn1c(SCc2ccc(Cl)cc2)nnc1C(C)NC(=O)c1ccccc1C |
| InChI | InChI=1S/C22H23ClN4OS/c1-4-13-27-20(16(3)24-21(28)19-8-6-5-7-15(19)2)25-26-22(27)29-14-17-9-11-18(23)12-10-17/h4-12,16H,1,13-14H2,2-3H3,(H,24,28) |
| InChIKey | VZTJACYZBNPUGY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|