About 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole
2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole (PubChem CID 5235190) has the molecular formula C18H12BrN3S2
and a molecular weight of 414.35 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole.
Molecular Properties
| Compound Name | 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole |
| PubChem CID | 5235190 |
| Molecular Formula | C18H12BrN3S2 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole |
| SMILES | Brc1ccc(C2=CC(c3cccs3)n3c(nc4ccccc43)N2)s1 |
| InChI | InChI=1S/C18H12BrN3S2/c19-17-8-7-15(24-17)12-10-14(16-6-3-9-23-16)22-13-5-2-1-4-11(13)20-18(22)21-12/h1-10,14H,(H,20,21) |
| InChIKey | HQFGGGVVKHTFDP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole?
The IUPAC name of 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole (CID 5235190) is 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole.
What is the SMILES notation for 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole?
The canonical SMILES for 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole is Brc1ccc(C2=CC(c3cccs3)n3c(nc4ccccc43)N2)s1.
What is the InChIKey of 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole?
The InChIKey is HQFGGGVVKHTFDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrN3S2/c19-17-8-7-15(24-17)12-10-14(16-6-3-9-23-16)22-13-5-2-1-4-11(13)20-18(22)21-12/h1-10,14H,(H,20,21).
What are the key properties of 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole?
2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole has a molecular weight of 414.35 g/mol, XLogP of 5.98, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromothiophen-2-yl)-4-thiophen-2-yl-1,4-dihydropyrimido[1,2-a]benzimidazole is sourced from PubChem (CID 5235190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).