C38H31Cl3O2 — CID 5235314
2,3-diphenylpent-4-en-2-yl 3,3,3-tris(4-chlorophenyl)propanoate (PubChem CID 5235314) has the molecular formula C38H31Cl3O2 and a molecular weight of 626.02 g/mol. Its IUPAC name is 2,3-diphenylpent-4-en-2-yl 3,3,3-tris(4-chlorophenyl)propanoate.
| Compound Name | 2,3-diphenylpent-4-en-2-yl 3,3,3-tris(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 5235314 |
| Molecular Formula | C38H31Cl3O2 |
| Molecular Weight | 626.02 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | 2,3-diphenylpent-4-en-2-yl 3,3,3-tris(4-chlorophenyl)propanoate |
| SMILES | C=CC(c1ccccc1)C(C)(OC(=O)CC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C38H31Cl3O2/c1-3-35(27-10-6-4-7-11-27)37(2,28-12-8-5-9-13-28)43-36(42)26-38(29-14-20-32(39)21-15-29,30-16-22-33(40)23-17-30)31-18-24-34(41)25-19-31/h3-25,35H,1,26H2,2H3 |
| InChIKey | IDANJHYNDRRSBF-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.02 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|