About 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole
1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole (PubChem CID 5235501) has the molecular formula C11H13Cl2P
and a molecular weight of 247.11 g/mol. Its IUPAC name is 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole.
Molecular Properties
| Compound Name | 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole |
| PubChem CID | 5235501 |
| Molecular Formula | C11H13Cl2P |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole |
| SMILES | CC1=CP(Cl)(Cl)(c2ccccc2)CC1 |
| InChI | InChI=1S/C11H13Cl2P/c1-10-7-8-14(12,13,9-10)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 |
| InChIKey | AEMRMAGLXFMHPL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole?
The IUPAC name of 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole (CID 5235501) is 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole.
What is the SMILES notation for 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole?
The canonical SMILES for 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole is CC1=CP(Cl)(Cl)(c2ccccc2)CC1.
What is the InChIKey of 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole?
The InChIKey is AEMRMAGLXFMHPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2P/c1-10-7-8-14(12,13,9-10)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3.
What are the key properties of 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole?
1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole has a molecular weight of 247.11 g/mol, XLogP of 4.48, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloro-4-methyl-1-phenyl-2,3-dihydro-1λ5-phosphole is sourced from PubChem (CID 5235501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).