About 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol
7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol (PubChem CID 523576) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol.
Molecular Properties
| Compound Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol |
| PubChem CID | 523576 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol |
| SMILES | OC1CCCC2C3CC(CN12)C1CCCCN1C3 |
| InChI | InChI=1S/C15H26N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h11-15,18H,1-10H2 |
| InChIKey | AFEKUFYCNWZEGZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol?
The IUPAC name of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol (CID 523576) is 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol.
What is the SMILES notation for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol?
The canonical SMILES for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol is OC1CCCC2C3CC(CN12)C1CCCCN1C3.
What is the InChIKey of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol?
The InChIKey is AFEKUFYCNWZEGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h11-15,18H,1-10H2.
What are the key properties of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol?
7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol has a molecular weight of 250.39 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-ol is sourced from PubChem (CID 523576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).