About 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one
5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one (PubChem CID 5236018) has the molecular formula C14H8Cl2OS2
and a molecular weight of 327.26 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one.
Molecular Properties
| Compound Name | 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one |
| PubChem CID | 5236018 |
| Molecular Formula | C14H8Cl2OS2 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 325.94 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one |
| SMILES | O=C1C(=Cc2ccc(Cl)cc2Cl)CSc2sccc21 |
| InChI | InChI=1S/C14H8Cl2OS2/c15-10-2-1-8(12(16)6-10)5-9-7-19-14-11(13(9)17)3-4-18-14/h1-6H,7H2 |
| InChIKey | TZXQLPCAHPJSBS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one?
The IUPAC name of 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one (CID 5236018) is 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one.
What is the SMILES notation for 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one?
The canonical SMILES for 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one is O=C1C(=Cc2ccc(Cl)cc2Cl)CSc2sccc21.
What is the InChIKey of 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one?
The InChIKey is TZXQLPCAHPJSBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2OS2/c15-10-2-1-8(12(16)6-10)5-9-7-19-14-11(13(9)17)3-4-18-14/h1-6H,7H2.
What are the key properties of 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one?
5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one has a molecular weight of 327.26 g/mol, XLogP of 5.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-dichlorophenyl)methylidene]thieno[2,3-b]thiopyran-4-one is sourced from PubChem (CID 5236018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).