1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid

C15H17N3O2S — CID 5236137

IUPAC1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid
SMILESO=C(O)C1CCCN(c2nc(Cc3ccccc3)ns2)C1
InChIInChI=1S/C15H17N3O2S/c19-14(20)12-7-4-8-18(10-12)15-16-13(17-21-15)9-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,19,20)
InChIKeyQFRBNIVSPFXEGH-UHFFFAOYSA-N
MW303.39 g/mol
LogP2.43
Rot. Bonds4

About 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid

1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid (PubChem CID 5236137) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid
PubChem CID5236137
Molecular FormulaC15H17N3O2S
Molecular Weight303.39 g/mol
Exact Mass303.10
IUPAC Name1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid
SMILESO=C(O)C1CCCN(c2nc(Cc3ccccc3)ns2)C1
InChIInChI=1S/C15H17N3O2S/c19-14(20)12-7-4-8-18(10-12)15-16-13(17-21-15)9-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,19,20)
InChIKeyQFRBNIVSPFXEGH-UHFFFAOYSA-N
XLogP2.43
TPSA66.32 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.39
LogP ≤ 52.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid?
The IUPAC name of 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid (CID 5236137) is 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid.
What is the SMILES notation for 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid?
The canonical SMILES for 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid is O=C(O)C1CCCN(c2nc(Cc3ccccc3)ns2)C1.
What is the InChIKey of 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid?
The InChIKey is QFRBNIVSPFXEGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2S/c19-14(20)12-7-4-8-18(10-12)15-16-13(17-21-15)9-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,19,20).
What are the key properties of 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid?
1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid has a molecular weight of 303.39 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid is sourced from PubChem (CID 5236137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).