C15H17N3O2S — CID 5236137
1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid (PubChem CID 5236137) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid.
| Compound Name | 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 5236137 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-(3-benzyl-1,2,4-thiadiazol-5-yl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(c2nc(Cc3ccccc3)ns2)C1 |
| InChI | InChI=1S/C15H17N3O2S/c19-14(20)12-7-4-8-18(10-12)15-16-13(17-21-15)9-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,19,20) |
| InChIKey | QFRBNIVSPFXEGH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |