About 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate
1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate (PubChem CID 5236565) has the molecular formula C22H25N3O4S
and a molecular weight of 427.53 g/mol. Its IUPAC name is 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate.
Molecular Properties
| Compound Name | 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate |
| PubChem CID | 5236565 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC(C)CN2CCN(C3=NS(=O)(=O)c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-16-7-9-18(10-8-16)22(26)29-17(2)15-24-11-13-25(14-12-24)21-19-5-3-4-6-20(19)30(27,28)23-21/h3-10,17H,11-15H2,1-2H3 |
| InChIKey | ITYRTPYRQXJRNZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate?
The IUPAC name of 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate (CID 5236565) is 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate.
What is the SMILES notation for 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate?
The canonical SMILES for 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate is Cc1ccc(C(=O)OC(C)CN2CCN(C3=NS(=O)(=O)c4ccccc43)CC2)cc1.
What is the InChIKey of 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate?
The InChIKey is ITYRTPYRQXJRNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O4S/c1-16-7-9-18(10-8-16)22(26)29-17(2)15-24-11-13-25(14-12-24)21-19-5-3-4-6-20(19)30(27,28)23-21/h3-10,17H,11-15H2,1-2H3.
What are the key properties of 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate?
1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate has a molecular weight of 427.53 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,1-dioxo-1,2-benzothiazol-3-yl)piperazin-1-yl]propan-2-yl 4-methylbenzoate is sourced from PubChem (CID 5236565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).