C24H18N2O3S2 — CID 5236919
4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-2,6-dimethoxyphenol (PubChem CID 5236919) has the molecular formula C24H18N2O3S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 5236919 |
| Molecular Formula | C24H18N2O3S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 4-[2,2-bis(1,3-benzothiazol-2-yl)ethenyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(C=C(c2nc3ccccc3s2)c2nc3ccccc3s2)cc(OC)c1O |
| InChI | InChI=1S/C24H18N2O3S2/c1-28-18-12-14(13-19(29-2)22(18)27)11-15(23-25-16-7-3-5-9-20(16)30-23)24-26-17-8-4-6-10-21(17)31-24/h3-13,27H,1-2H3 |
| InChIKey | SELVEPWNEOLSKB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |