C32H66N2O5+2 — CID 5237040
(2-decoxy-2-oxoethyl)-[2-[2-[(2-decoxy-2-oxoethyl)-dimethylazaniumyl]ethoxy]ethyl]-dimethylazanium (PubChem CID 5237040) has the molecular formula C32H66N2O5+2 and a molecular weight of 558.89 g/mol. Its IUPAC name is (2-decoxy-2-oxoethyl)-[2-[2-[(2-decoxy-2-oxoethyl)-dimethylazaniumyl]ethoxy]ethyl]-dimethylazanium.
| Compound Name | (2-decoxy-2-oxoethyl)-[2-[2-[(2-decoxy-2-oxoethyl)-dimethylazaniumyl]ethoxy]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 5237040 |
| Molecular Formula | C32H66N2O5+2 |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.50 |
| IUPAC Name | (2-decoxy-2-oxoethyl)-[2-[2-[(2-decoxy-2-oxoethyl)-dimethylazaniumyl]ethoxy]ethyl]-dimethylazanium |
| SMILES | CCCCCCCCCCOC(=O)C[N+](C)(C)CCOCC[N+](C)(C)CC(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C32H66N2O5/c1-7-9-11-13-15-17-19-21-25-38-31(35)29-33(3,4)23-27-37-28-24-34(5,6)30-32(36)39-26-22-20-18-16-14-12-10-8-2/h7-30H2,1-6H3/q+2 |
| InChIKey | GSRISTCZRRLNLT-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|