About 5,8-diethynyl-2,3-diphenylquinoxaline
5,8-diethynyl-2,3-diphenylquinoxaline (PubChem CID 5237239) has the molecular formula C24H14N2
and a molecular weight of 330.39 g/mol. Its IUPAC name is 5,8-diethynyl-2,3-diphenylquinoxaline.
Molecular Properties
| Compound Name | 5,8-diethynyl-2,3-diphenylquinoxaline |
| PubChem CID | 5237239 |
| Molecular Formula | C24H14N2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5,8-diethynyl-2,3-diphenylquinoxaline |
| SMILES | C#Cc1ccc(C#C)c2nc(-c3ccccc3)c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C24H14N2/c1-3-17-15-16-18(4-2)22-21(17)25-23(19-11-7-5-8-12-19)24(26-22)20-13-9-6-10-14-20/h1-2,5-16H |
| InChIKey | AGAFSCQKJFATLC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,8-diethynyl-2,3-diphenylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-diethynyl-2,3-diphenylquinoxaline?
The IUPAC name of 5,8-diethynyl-2,3-diphenylquinoxaline (CID 5237239) is 5,8-diethynyl-2,3-diphenylquinoxaline.
What is the SMILES notation for 5,8-diethynyl-2,3-diphenylquinoxaline?
The canonical SMILES for 5,8-diethynyl-2,3-diphenylquinoxaline is C#Cc1ccc(C#C)c2nc(-c3ccccc3)c(-c3ccccc3)nc12.
What is the InChIKey of 5,8-diethynyl-2,3-diphenylquinoxaline?
The InChIKey is AGAFSCQKJFATLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14N2/c1-3-17-15-16-18(4-2)22-21(17)25-23(19-11-7-5-8-12-19)24(26-22)20-13-9-6-10-14-20/h1-2,5-16H.
What are the key properties of 5,8-diethynyl-2,3-diphenylquinoxaline?
5,8-diethynyl-2,3-diphenylquinoxaline has a molecular weight of 330.39 g/mol, XLogP of 4.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-diethynyl-2,3-diphenylquinoxaline is sourced from PubChem (CID 5237239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).