C16H11ClN2O — CID 5237288
2-chloro-N-isoquinolin-3-ylbenzamide (PubChem CID 5237288) has the molecular formula C16H11ClN2O and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-chloro-N-isoquinolin-3-ylbenzamide.
| Compound Name | 2-chloro-N-isoquinolin-3-ylbenzamide |
|---|---|
| PubChem CID | 5237288 |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-chloro-N-isoquinolin-3-ylbenzamide |
| SMILES | O=C(Nc1cc2ccccc2cn1)c1ccccc1Cl |
| InChI | InChI=1S/C16H11ClN2O/c17-14-8-4-3-7-13(14)16(20)19-15-9-11-5-1-2-6-12(11)10-18-15/h1-10H,(H,18,19,20) |
| InChIKey | NDAKSQVBLLLQMO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |