About [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone
[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 5237348) has the molecular formula C19H24N4O3
and a molecular weight of 356.43 g/mol. Its IUPAC name is [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone |
| PubChem CID | 5237348 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | Cc1nn(Cc2cccc(C(=O)N3CCCC(C)C3)c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N4O3/c1-13-6-5-9-21(11-13)19(24)17-8-4-7-16(10-17)12-22-15(3)18(23(25)26)14(2)20-22/h4,7-8,10,13H,5-6,9,11-12H2,1-3H3 |
| InChIKey | ISVPUBKPVCCCLW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone?
The IUPAC name of [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone (CID 5237348) is [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone.
What is the SMILES notation for [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone?
The canonical SMILES for [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone is Cc1nn(Cc2cccc(C(=O)N3CCCC(C)C3)c2)c(C)c1[N+](=O)[O-].
What is the InChIKey of [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone?
The InChIKey is ISVPUBKPVCCCLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O3/c1-13-6-5-9-21(11-13)19(24)17-8-4-7-16(10-17)12-22-15(3)18(23(25)26)14(2)20-22/h4,7-8,10,13H,5-6,9,11-12H2,1-3H3.
What are the key properties of [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone?
[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone has a molecular weight of 356.43 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]-(3-methylpiperidin-1-yl)methanone is sourced from PubChem (CID 5237348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).