C18H18O3 — CID 5237651
12-(hydroxymethyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5-carboxylic acid (PubChem CID 5237651) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 12-(hydroxymethyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5-carboxylic acid.
| Compound Name | 12-(hydroxymethyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 5237651 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 12-(hydroxymethyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5-carboxylic acid |
| SMILES | O=C(O)c1cc2ccc1CCc1ccc(cc1CO)CC2 |
| InChI | InChI=1S/C18H18O3/c19-11-16-9-12-1-2-13-4-6-15(17(10-13)18(20)21)8-7-14(16)5-3-12/h3-6,9-10,19H,1-2,7-8,11H2,(H,20,21) |
| InChIKey | OQGCOFCDPLZJDO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |