About 4-chloro-2-methylheptane
4-chloro-2-methylheptane (PubChem CID 523769) has the molecular formula C8H17Cl
and a molecular weight of 148.68 g/mol. Its IUPAC name is 4-chloro-2-methylheptane.
Molecular Properties
| Compound Name | 4-chloro-2-methylheptane |
| PubChem CID | 523769 |
| Molecular Formula | C8H17Cl |
| Molecular Weight | 148.68 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4-chloro-2-methylheptane |
| SMILES | CCCC(Cl)CC(C)C |
| InChI | InChI=1S/C8H17Cl/c1-4-5-8(9)6-7(2)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | NZPCEFUPEFPZSY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-methylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methylheptane?
The IUPAC name of 4-chloro-2-methylheptane (CID 523769) is 4-chloro-2-methylheptane.
What is the SMILES notation for 4-chloro-2-methylheptane?
The canonical SMILES for 4-chloro-2-methylheptane is CCCC(Cl)CC(C)C.
What is the InChIKey of 4-chloro-2-methylheptane?
The InChIKey is NZPCEFUPEFPZSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17Cl/c1-4-5-8(9)6-7(2)3/h7-8H,4-6H2,1-3H3.
What are the key properties of 4-chloro-2-methylheptane?
4-chloro-2-methylheptane has a molecular weight of 148.68 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methylheptane is sourced from PubChem (CID 523769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).