About N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine
N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine (PubChem CID 5237949) has the molecular formula C14H12N4O2S
and a molecular weight of 300.34 g/mol. Its IUPAC name is N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine.
Molecular Properties
| Compound Name | N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine |
| PubChem CID | 5237949 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine |
| SMILES | CN(N=Cc1ccccn1)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C14H12N4O2S/c1-18(16-10-11-6-4-5-9-15-11)14-12-7-2-3-8-13(12)21(19,20)17-14/h2-10H,1H3 |
| InChIKey | KKQROYUBAKNCOR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 74.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine?
The IUPAC name of N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine (CID 5237949) is N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine.
What is the SMILES notation for N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine?
The canonical SMILES for N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine is CN(N=Cc1ccccn1)C1=NS(=O)(=O)c2ccccc21.
What is the InChIKey of N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine?
The InChIKey is KKQROYUBAKNCOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O2S/c1-18(16-10-11-6-4-5-9-15-11)14-12-7-2-3-8-13(12)21(19,20)17-14/h2-10H,1H3.
What are the key properties of N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine?
N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine has a molecular weight of 300.34 g/mol, XLogP of 1.50, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,1-dioxo-N-(pyridin-2-ylmethylideneamino)-1,2-benzothiazol-3-amine is sourced from PubChem (CID 5237949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).