C31H46FN5O4 — CID 5238210
N-(2,4-dimethoxyphenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide (PubChem CID 5238210) has the molecular formula C31H46FN5O4 and a molecular weight of 571.74 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 5238210 |
| Molecular Formula | C31H46FN5O4 |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)N(CCN1CCN(C(=O)Nc2ccc(OC)cc2OC)CC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C31H46FN5O4/c1-4-5-6-7-8-9-16-33-30(38)37(24-25-10-12-26(32)13-11-25)22-19-35-17-20-36(21-18-35)31(39)34-28-15-14-27(40-2)23-29(28)41-3/h10-15,23H,4-9,16-22,24H2,1-3H3,(H,33,38)(H,34,39) |
| InChIKey | DDFQDQXUOVRUGM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|