About dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol)
dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol) (PubChem CID 5238937) has the molecular formula C28H34Cl2CoN2O2
and a molecular weight of 560.43 g/mol. Its IUPAC name is dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol).
Molecular Properties
| Compound Name | dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol) |
| PubChem CID | 5238937 |
| Molecular Formula | C28H34Cl2CoN2O2 |
| Molecular Weight | 560.43 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol) |
| SMILES | Cc1ccc(NCC2C=CC=CC2O)cc1.Cc1ccc(NCC2C=CC=CC2O)cc1.Cl[Co]Cl |
| InChI | InChI=1S/2C14H17NO.2ClH.Co/c2*1-11-6-8-13(9-7-11)15-10-12-4-2-3-5-14(12)16;;;/h2*2-9,12,14-16H,10H2,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | GAIXIVFPBIBKJV-UHFFFAOYSA-L |
| XLogP | 6.40 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.43 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol)?
The IUPAC name of dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol) (CID 5238937) is dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol).
What is the SMILES notation for dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol)?
The canonical SMILES for dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol) is Cc1ccc(NCC2C=CC=CC2O)cc1.Cc1ccc(NCC2C=CC=CC2O)cc1.Cl[Co]Cl.
What is the InChIKey of dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol)?
The InChIKey is GAIXIVFPBIBKJV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C14H17NO.2ClH.Co/c2*1-11-6-8-13(9-7-11)15-10-12-4-2-3-5-14(12)16;;;/h2*2-9,12,14-16H,10H2,1H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol)?
dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol) has a molecular weight of 560.43 g/mol, XLogP of 6.40, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocobalt;bis(6-[(4-methylanilino)methyl]cyclohexa-2,4-dien-1-ol) is sourced from PubChem (CID 5238937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).