C18H33NO4 — CID 5239019
tert-butyl 5-(3-hydroxy-4-methylhex-5-en-2-yl)-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 5239019) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl 5-(3-hydroxy-4-methylhex-5-en-2-yl)-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 5-(3-hydroxy-4-methylhex-5-en-2-yl)-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 5239019 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | tert-butyl 5-(3-hydroxy-4-methylhex-5-en-2-yl)-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CC(C)C(O)C(C)C1OC(C)(C)N(C(=O)OC(C)(C)C)C1C |
| InChI | InChI=1S/C18H33NO4/c1-10-11(2)14(20)12(3)15-13(4)19(18(8,9)22-15)16(21)23-17(5,6)7/h10-15,20H,1H2,2-9H3 |
| InChIKey | FBFBHMFJYSHVAI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|