C17H40N4 — CID 5239027
2-N,4-N-bis[2-(diethylamino)ethyl]pentane-2,4-diamine (PubChem CID 5239027) has the molecular formula C17H40N4 and a molecular weight of 300.53 g/mol. Its IUPAC name is 2-N,4-N-bis[2-(diethylamino)ethyl]pentane-2,4-diamine.
| Compound Name | 2-N,4-N-bis[2-(diethylamino)ethyl]pentane-2,4-diamine |
|---|---|
| PubChem CID | 5239027 |
| Molecular Formula | C17H40N4 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.33 |
| IUPAC Name | 2-N,4-N-bis[2-(diethylamino)ethyl]pentane-2,4-diamine |
| SMILES | CCN(CC)CCNC(C)CC(C)NCCN(CC)CC |
| InChI | InChI=1S/C17H40N4/c1-7-20(8-2)13-11-18-16(5)15-17(6)19-12-14-21(9-3)10-4/h16-19H,7-15H2,1-6H3 |
| InChIKey | YKLUCOUUKYRZIG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |