C17H22BrNO3S — CID 5239351
3-(4-bromophenyl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 5239351) has the molecular formula C17H22BrNO3S and a molecular weight of 400.34 g/mol. Its IUPAC name is 3-(4-bromophenyl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | 3-(4-bromophenyl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 5239351 |
| Molecular Formula | C17H22BrNO3S |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 3-(4-bromophenyl)sulfonyl-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc(Br)cc1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H22BrNO3S/c18-15-6-8-16(9-7-15)23(21,22)13-11-17(20)19-12-10-14-4-2-1-3-5-14/h4,6-9H,1-3,5,10-13H2,(H,19,20) |
| InChIKey | CMDFMSSOVSASKI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|