C16H14N4O3S2 — CID 5239489
2-[[2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide (PubChem CID 5239489) has the molecular formula C16H14N4O3S2 and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-[[2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 5239489 |
| Molecular Formula | C16H14N4O3S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-[[2-(3-methyl-4-oxoquinazolin-2-yl)sulfanylacetyl]amino]thiophene-3-carboxamide |
| SMILES | Cn1c(SCC(=O)Nc2sccc2C(N)=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C16H14N4O3S2/c1-20-15(23)9-4-2-3-5-11(9)18-16(20)25-8-12(21)19-14-10(13(17)22)6-7-24-14/h2-7H,8H2,1H3,(H2,17,22)(H,19,21) |
| InChIKey | FGTRLAKOASFRSP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |