C13H24N2O11 — CID 5239774
1,3-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea (PubChem CID 5239774) has the molecular formula C13H24N2O11 and a molecular weight of 384.34 g/mol. Its IUPAC name is 1,3-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea.
| Compound Name | 1,3-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea |
|---|---|
| PubChem CID | 5239774 |
| Molecular Formula | C13H24N2O11 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1,3-bis[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea |
| SMILES | O=C(NC1OC(CO)C(O)C(O)C1O)NC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C13H24N2O11/c16-1-3-5(18)7(20)9(22)11(25-3)14-13(24)15-12-10(23)8(21)6(19)4(2-17)26-12/h3-12,16-23H,1-2H2,(H2,14,15,24) |
| InChIKey | LYERYMMRBCPBEP-UHFFFAOYSA-N |
| XLogP | -6.11 |
| TPSA | 221.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | -6.11 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |