About 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine
1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine (PubChem CID 5240172) has the molecular formula C17H15F3N4O6S
and a molecular weight of 460.39 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine |
| PubChem CID | 5240172 |
| Molecular Formula | C17H15F3N4O6S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H15F3N4O6S/c18-17(19,20)12-10-14(23(25)26)16(15(11-12)24(27)28)21-6-8-22(9-7-21)31(29,30)13-4-2-1-3-5-13/h1-5,10-11H,6-9H2 |
| InChIKey | DLSMZINFOOZQFN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine?
The IUPAC name of 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine (CID 5240172) is 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine.
What is the SMILES notation for 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine?
The canonical SMILES for 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine is O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1N1CCN(S(=O)(=O)c2ccccc2)CC1.
What is the InChIKey of 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine?
The InChIKey is DLSMZINFOOZQFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N4O6S/c18-17(19,20)12-10-14(23(25)26)16(15(11-12)24(27)28)21-6-8-22(9-7-21)31(29,30)13-4-2-1-3-5-13/h1-5,10-11H,6-9H2.
What are the key properties of 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine?
1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine has a molecular weight of 460.39 g/mol, XLogP of 3.03, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperazine is sourced from PubChem (CID 5240172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).