About 2-butan-2-ylpiperidine
2-butan-2-ylpiperidine (PubChem CID 5240621) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 2-butan-2-ylpiperidine.
Molecular Properties
| Compound Name | 2-butan-2-ylpiperidine |
| PubChem CID | 5240621 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 2-butan-2-ylpiperidine |
| SMILES | CCC(C)C1CCCCN1 |
| InChI | InChI=1S/C9H19N/c1-3-8(2)9-6-4-5-7-10-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | CGPFWODSWBWMPM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-butan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-ylpiperidine?
The IUPAC name of 2-butan-2-ylpiperidine (CID 5240621) is 2-butan-2-ylpiperidine.
What is the SMILES notation for 2-butan-2-ylpiperidine?
The canonical SMILES for 2-butan-2-ylpiperidine is CCC(C)C1CCCCN1.
What is the InChIKey of 2-butan-2-ylpiperidine?
The InChIKey is CGPFWODSWBWMPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N/c1-3-8(2)9-6-4-5-7-10-9/h8-10H,3-7H2,1-2H3.
What are the key properties of 2-butan-2-ylpiperidine?
2-butan-2-ylpiperidine has a molecular weight of 141.26 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-ylpiperidine is sourced from PubChem (CID 5240621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).