About 2-methyl-2,3-dihydrofuran-3-thiol
2-methyl-2,3-dihydrofuran-3-thiol (PubChem CID 524174) has the molecular formula C5H8OS
and a molecular weight of 116.18 g/mol. Its IUPAC name is 2-methyl-2,3-dihydrofuran-3-thiol.
Molecular Properties
| Compound Name | 2-methyl-2,3-dihydrofuran-3-thiol |
| PubChem CID | 524174 |
| Molecular Formula | C5H8OS |
| Molecular Weight | 116.18 g/mol |
| Exact Mass | 116.03 |
| IUPAC Name | 2-methyl-2,3-dihydrofuran-3-thiol |
| SMILES | CC1OC=CC1S |
| InChI | InChI=1S/C5H8OS/c1-4-5(7)2-3-6-4/h2-5,7H,1H3 |
| InChIKey | PZGLKZTWQCEEIT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2,3-dihydrofuran-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3-dihydrofuran-3-thiol?
The IUPAC name of 2-methyl-2,3-dihydrofuran-3-thiol (CID 524174) is 2-methyl-2,3-dihydrofuran-3-thiol.
What is the SMILES notation for 2-methyl-2,3-dihydrofuran-3-thiol?
The canonical SMILES for 2-methyl-2,3-dihydrofuran-3-thiol is CC1OC=CC1S.
What is the InChIKey of 2-methyl-2,3-dihydrofuran-3-thiol?
The InChIKey is PZGLKZTWQCEEIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8OS/c1-4-5(7)2-3-6-4/h2-5,7H,1H3.
What are the key properties of 2-methyl-2,3-dihydrofuran-3-thiol?
2-methyl-2,3-dihydrofuran-3-thiol has a molecular weight of 116.18 g/mol, XLogP of 1.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3-dihydrofuran-3-thiol is sourced from PubChem (CID 524174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).