C15H24O2 — CID 5241820
1,6,6,9-tetramethyl-4,13-dioxatricyclo[10.1.0.03,5]tridec-8-ene (PubChem CID 5241820) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 1,6,6,9-tetramethyl-4,13-dioxatricyclo[10.1.0.03,5]tridec-8-ene.
| Compound Name | 1,6,6,9-tetramethyl-4,13-dioxatricyclo[10.1.0.03,5]tridec-8-ene |
|---|---|
| PubChem CID | 5241820 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1,6,6,9-tetramethyl-4,13-dioxatricyclo[10.1.0.03,5]tridec-8-ene |
| SMILES | CC1=CCC(C)(C)C2OC2CC2(C)OC2CC1 |
| InChI | InChI=1S/C15H24O2/c1-10-5-6-12-15(4,17-12)9-11-13(16-11)14(2,3)8-7-10/h7,11-13H,5-6,8-9H2,1-4H3 |
| InChIKey | VCIHKOLXNNWKMC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|