C26H42O5Si — CID 5241924
9b-hydroxy-3a,3b-dimethyl-7-prop-1-en-2-yl-8-triethylsilyloxy-4,5,5a,7,8,10,11,11a-octahydro-1H-[2]benzofuro[6,7-f]chromen-3-one (PubChem CID 5241924) has the molecular formula C26H42O5Si and a molecular weight of 462.70 g/mol. Its IUPAC name is 9b-hydroxy-3a,3b-dimethyl-7-prop-1-en-2-yl-8-triethylsilyloxy-4,5,5a,7,8,10,11,11a-octahydro-1H-[2]benzofuro[6,7-f]chromen-3-one.
| Compound Name | 9b-hydroxy-3a,3b-dimethyl-7-prop-1-en-2-yl-8-triethylsilyloxy-4,5,5a,7,8,10,11,11a-octahydro-1H-[2]benzofuro[6,7-f]chromen-3-one |
|---|---|
| PubChem CID | 5241924 |
| Molecular Formula | C26H42O5Si |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | 9b-hydroxy-3a,3b-dimethyl-7-prop-1-en-2-yl-8-triethylsilyloxy-4,5,5a,7,8,10,11,11a-octahydro-1H-[2]benzofuro[6,7-f]chromen-3-one |
| SMILES | C=C(C)C1OC2CCC3(C)C(O)(CCC4COC(=O)C43C)C2=CC1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H42O5Si/c1-8-32(9-2,10-3)31-21-15-19-20(30-22(21)17(4)5)12-13-24(6)25(7)18(16-29-23(25)27)11-14-26(19,24)28/h15,18,20-22,28H,4,8-14,16H2,1-3,5-7H3 |
| InChIKey | MRHPGEPVBNRERM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|