C28H10F10S — CID 5242161
3,4-bis(2,3,4,5,6-pentafluorophenyl)-2,5-diphenylthiophene (PubChem CID 5242161) has the molecular formula C28H10F10S and a molecular weight of 568.44 g/mol. Its IUPAC name is 3,4-bis(2,3,4,5,6-pentafluorophenyl)-2,5-diphenylthiophene.
| Compound Name | 3,4-bis(2,3,4,5,6-pentafluorophenyl)-2,5-diphenylthiophene |
|---|---|
| PubChem CID | 5242161 |
| Molecular Formula | C28H10F10S |
| Molecular Weight | 568.44 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | 3,4-bis(2,3,4,5,6-pentafluorophenyl)-2,5-diphenylthiophene |
| SMILES | Fc1c(F)c(F)c(-c2c(-c3ccccc3)sc(-c3ccccc3)c2-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C28H10F10S/c29-17-15(18(30)22(34)25(37)21(17)33)13-14(16-19(31)23(35)26(38)24(36)20(16)32)28(12-9-5-2-6-10-12)39-27(13)11-7-3-1-4-8-11/h1-10H |
| InChIKey | CLSBKCQWQUOUIJ-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.44 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|