C38H40N10O2 — CID 5242179
N,N-bis(1H-benzimidazol-2-ylmethyl)-2-[2-[2-[bis(1H-benzimidazol-2-ylmethyl)amino]ethoxy]ethoxy]ethanamine (PubChem CID 5242179) has the molecular formula C38H40N10O2 and a molecular weight of 668.81 g/mol. Its IUPAC name is N,N-bis(1H-benzimidazol-2-ylmethyl)-2-[2-[2-[bis(1H-benzimidazol-2-ylmethyl)amino]ethoxy]ethoxy]ethanamine.
| Compound Name | N,N-bis(1H-benzimidazol-2-ylmethyl)-2-[2-[2-[bis(1H-benzimidazol-2-ylmethyl)amino]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 5242179 |
| Molecular Formula | C38H40N10O2 |
| Molecular Weight | 668.81 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | N,N-bis(1H-benzimidazol-2-ylmethyl)-2-[2-[2-[bis(1H-benzimidazol-2-ylmethyl)amino]ethoxy]ethoxy]ethanamine |
| SMILES | c1ccc2[nH]c(CN(CCOCCOCCN(Cc3nc4ccccc4[nH]3)Cc3nc4ccccc4[nH]3)Cc3nc4ccccc4[nH]3)nc2c1 |
| InChI | InChI=1S/C38H40N10O2/c1-2-10-28-27(9-1)39-35(40-28)23-47(24-36-41-29-11-3-4-12-30(29)42-36)17-19-49-21-22-50-20-18-48(25-37-43-31-13-5-6-14-32(31)44-37)26-38-45-33-15-7-8-16-34(33)46-38/h1-16H,17-26H2,(H,39,40)(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | WYSVQDUIWSLSLY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 139.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|