About 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione
1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione (PubChem CID 5242397) has the molecular formula C22H21NO2
and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione |
| PubChem CID | 5242397 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione |
| SMILES | O=C1C(c2ccccc2)=C(c2ccccc2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C22H21NO2/c24-21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)22(25)23(21)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2 |
| InChIKey | GRNPKHZKMCIRIP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione?
The IUPAC name of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione (CID 5242397) is 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione.
What is the SMILES notation for 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione?
The canonical SMILES for 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione is O=C1C(c2ccccc2)=C(c2ccccc2)C(=O)N1C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione?
The InChIKey is GRNPKHZKMCIRIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO2/c24-21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)22(25)23(21)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2.
What are the key properties of 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione?
1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione has a molecular weight of 331.42 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3,4-diphenylpyrrole-2,5-dione is sourced from PubChem (CID 5242397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).