About 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium
2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium (PubChem CID 5242456) has the molecular formula C21H27Cl3NO2Ti
and a molecular weight of 479.68 g/mol. Its IUPAC name is 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium.
Molecular Properties
| Compound Name | 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium |
| PubChem CID | 5242456 |
| Molecular Formula | C21H27Cl3NO2Ti |
| Molecular Weight | 479.68 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium |
| SMILES | C1CCOC1.CC(C)(C)c1cccc(/C=N/c2ccccc2)c1O.Cl[Ti](Cl)Cl |
| InChI | InChI=1S/C17H19NO.C4H8O.3ClH.Ti/c1-17(2,3)15-11-7-8-13(16(15)19)12-18-14-9-5-4-6-10-14;1-2-4-5-3-1;;;;/h4-12,19H,1-3H3;1-4H2;3*1H;/q;;;;;+3/p-3/b18-12+;;;;; |
| InChIKey | NGMMQOIKOCNDCL-UZTHEFBISA-K |
| XLogP | 7.30 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.68 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium?
The IUPAC name of 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium (CID 5242456) is 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium.
What is the SMILES notation for 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium?
The canonical SMILES for 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium is C1CCOC1.CC(C)(C)c1cccc(/C=N/c2ccccc2)c1O.Cl[Ti](Cl)Cl.
What is the InChIKey of 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium?
The InChIKey is NGMMQOIKOCNDCL-UZTHEFBISA-K. The full InChI is InChI=1S/C17H19NO.C4H8O.3ClH.Ti/c1-17(2,3)15-11-7-8-13(16(15)19)12-18-14-9-5-4-6-10-14;1-2-4-5-3-1;;;;/h4-12,19H,1-3H3;1-4H2;3*1H;/q;;;;;+3/p-3/b18-12+;;;;;.
What are the key properties of 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium?
2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium has a molecular weight of 479.68 g/mol, XLogP of 7.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-(phenyliminomethyl)phenol;oxolane;trichlorotitanium is sourced from PubChem (CID 5242456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).