About 3-aminopropane-1,1-diol
3-aminopropane-1,1-diol (PubChem CID 5242570) has the molecular formula C3H9NO2
and a molecular weight of 91.11 g/mol. Its IUPAC name is 3-aminopropane-1,1-diol.
Molecular Properties
| Compound Name | 3-aminopropane-1,1-diol |
| PubChem CID | 5242570 |
| Molecular Formula | C3H9NO2 |
| Molecular Weight | 91.11 g/mol |
| Exact Mass | 91.06 |
| IUPAC Name | 3-aminopropane-1,1-diol |
| SMILES | NCCC(O)O |
| InChI | InChI=1S/C3H9NO2/c4-2-1-3(5)6/h3,5-6H,1-2,4H2 |
| InChIKey | VACJHIUSZPBOOF-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.11 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropane-1,1-diol?
The IUPAC name of 3-aminopropane-1,1-diol (CID 5242570) is 3-aminopropane-1,1-diol.
What is the SMILES notation for 3-aminopropane-1,1-diol?
The canonical SMILES for 3-aminopropane-1,1-diol is NCCC(O)O.
What is the InChIKey of 3-aminopropane-1,1-diol?
The InChIKey is VACJHIUSZPBOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO2/c4-2-1-3(5)6/h3,5-6H,1-2,4H2.
What are the key properties of 3-aminopropane-1,1-diol?
3-aminopropane-1,1-diol has a molecular weight of 91.11 g/mol, XLogP of -1.35, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropane-1,1-diol is sourced from PubChem (CID 5242570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).