About CID 5242816
CID 5242816 (PubChem CID 5242816) has the molecular formula C44H52CuF20N4-4
and a molecular weight of 1080.43 g/mol.
Molecular Properties
| Compound Name | CID 5242816 |
| PubChem CID | 5242816 |
| Molecular Formula | C44H52CuF20N4-4 |
| Molecular Weight | 1080.43 g/mol |
| Exact Mass | 1079.32 |
| IUPAC Name | — |
| SMILES | FC1C(F)C(F)C(C2C3[CH-]C(NC3)C(C3C(F)C(F)C(F)C(F)C3F)C3CCC([N-]3)C(C3C(F)C(F)C(F)C(F)C3F)C3[CH-]C(NC3)C(C3C(F)C(F)C(F)C(F)C3F)C3CCC2[N-]3)C(F)C1F.[Cu] |
| InChI | InChI=1S/C44H52F20N4.Cu/c45-25-21(26(46)34(54)41(61)33(25)53)17-9-5-16(65-7-9)20(24-31(51)39(59)44(64)40(60)32(24)52)14-4-2-12(68-14)18(22-27(47)35(55)42(62)36(56)28(22)48)10-6-15(66-8-10)19(13-3-1-11(17)67-13)23-29(49)37(57)43(63)38(58)30(23)50;/h5-6,9-44,65-66H,1-4,7-8H2;/q-4; |
| InChIKey | KGVSLCIRSHQINJ-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 52.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 69 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1080.43 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 5242816 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5242816?
The IUPAC name of CID 5242816 (CID 5242816) is not available.
What is the SMILES notation for CID 5242816?
The canonical SMILES for CID 5242816 is FC1C(F)C(F)C(C2C3[CH-]C(NC3)C(C3C(F)C(F)C(F)C(F)C3F)C3CCC([N-]3)C(C3C(F)C(F)C(F)C(F)C3F)C3[CH-]C(NC3)C(C3C(F)C(F)C(F)C(F)C3F)C3CCC2[N-]3)C(F)C1F.[Cu].
What is the InChIKey of CID 5242816?
The InChIKey is KGVSLCIRSHQINJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H52F20N4.Cu/c45-25-21(26(46)34(54)41(61)33(25)53)17-9-5-16(65-7-9)20(24-31(51)39(59)44(64)40(60)32(24)52)14-4-2-12(68-14)18(22-27(47)35(55)42(62)36(56)28(22)48)10-6-15(66-8-10)19(13-3-1-11(17)67-13)23-29(49)37(57)43(63)38(58)30(23)50;/h5-6,9-44,65-66H,1-4,7-8H2;/q-4;.
What are the key properties of CID 5242816?
CID 5242816 has a molecular weight of 1080.43 g/mol, XLogP of 9.14, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5242816 is sourced from PubChem (CID 5242816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).