About 4-chloro-1,2-bis(chloromethyl)benzene
4-chloro-1,2-bis(chloromethyl)benzene (PubChem CID 524307) has the molecular formula C8H7Cl3
and a molecular weight of 209.50 g/mol. Its IUPAC name is 4-chloro-1,2-bis(chloromethyl)benzene.
Molecular Properties
| Compound Name | 4-chloro-1,2-bis(chloromethyl)benzene |
| PubChem CID | 524307 |
| Molecular Formula | C8H7Cl3 |
| Molecular Weight | 209.50 g/mol |
| Exact Mass | 207.96 |
| IUPAC Name | 4-chloro-1,2-bis(chloromethyl)benzene |
| SMILES | ClCc1ccc(Cl)cc1CCl |
| InChI | InChI=1S/C8H7Cl3/c9-4-6-1-2-8(11)3-7(6)5-10/h1-3H,4-5H2 |
| InChIKey | SBXAWQQSJQEERL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1,2-bis(chloromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,2-bis(chloromethyl)benzene?
The IUPAC name of 4-chloro-1,2-bis(chloromethyl)benzene (CID 524307) is 4-chloro-1,2-bis(chloromethyl)benzene.
What is the SMILES notation for 4-chloro-1,2-bis(chloromethyl)benzene?
The canonical SMILES for 4-chloro-1,2-bis(chloromethyl)benzene is ClCc1ccc(Cl)cc1CCl.
What is the InChIKey of 4-chloro-1,2-bis(chloromethyl)benzene?
The InChIKey is SBXAWQQSJQEERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl3/c9-4-6-1-2-8(11)3-7(6)5-10/h1-3H,4-5H2.
What are the key properties of 4-chloro-1,2-bis(chloromethyl)benzene?
4-chloro-1,2-bis(chloromethyl)benzene has a molecular weight of 209.50 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,2-bis(chloromethyl)benzene is sourced from PubChem (CID 524307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).