About 1-butyl-4-chlorobenzene
1-butyl-4-chlorobenzene (PubChem CID 524314) has the molecular formula C10H13Cl
and a molecular weight of 168.67 g/mol. Its IUPAC name is 1-butyl-4-chlorobenzene.
Molecular Properties
| Compound Name | 1-butyl-4-chlorobenzene |
| PubChem CID | 524314 |
| Molecular Formula | C10H13Cl |
| Molecular Weight | 168.67 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 1-butyl-4-chlorobenzene |
| SMILES | CCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13Cl/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4H2,1H3 |
| InChIKey | SKNUPXIXICTRJE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyl-4-chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-chlorobenzene?
The IUPAC name of 1-butyl-4-chlorobenzene (CID 524314) is 1-butyl-4-chlorobenzene.
What is the SMILES notation for 1-butyl-4-chlorobenzene?
The canonical SMILES for 1-butyl-4-chlorobenzene is CCCCc1ccc(Cl)cc1.
What is the InChIKey of 1-butyl-4-chlorobenzene?
The InChIKey is SKNUPXIXICTRJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4H2,1H3.
What are the key properties of 1-butyl-4-chlorobenzene?
1-butyl-4-chlorobenzene has a molecular weight of 168.67 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-chlorobenzene is sourced from PubChem (CID 524314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).