C20H23N2OS+ — CID 5243162
1-benzyl-2-(4-methylphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol (PubChem CID 5243162) has the molecular formula C20H23N2OS+ and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-benzyl-2-(4-methylphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol.
| Compound Name | 1-benzyl-2-(4-methylphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
|---|---|
| PubChem CID | 5243162 |
| Molecular Formula | C20H23N2OS+ |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-benzyl-2-(4-methylphenyl)-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
| SMILES | Cc1ccc(C2(O)C[N+]3=C(SCCC3)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23N2OS/c1-16-8-10-18(11-9-16)20(23)15-21-12-5-13-24-19(21)22(20)14-17-6-3-2-4-7-17/h2-4,6-11,23H,5,12-15H2,1H3/q+1 |
| InChIKey | YJILHKICIZMOQN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|