C31H28N4O3 — CID 5244199
1-[1-(3-benzyl-4-oxoquinazolin-2-yl)ethyl]-1-(4-methoxyphenyl)-3-phenylurea (PubChem CID 5244199) has the molecular formula C31H28N4O3 and a molecular weight of 504.59 g/mol. Its IUPAC name is 1-[1-(3-benzyl-4-oxoquinazolin-2-yl)ethyl]-1-(4-methoxyphenyl)-3-phenylurea.
| Compound Name | 1-[1-(3-benzyl-4-oxoquinazolin-2-yl)ethyl]-1-(4-methoxyphenyl)-3-phenylurea |
|---|---|
| PubChem CID | 5244199 |
| Molecular Formula | C31H28N4O3 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 1-[1-(3-benzyl-4-oxoquinazolin-2-yl)ethyl]-1-(4-methoxyphenyl)-3-phenylurea |
| SMILES | COc1ccc(N(C(=O)Nc2ccccc2)C(C)c2nc3ccccc3c(=O)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C31H28N4O3/c1-22(35(25-17-19-26(38-2)20-18-25)31(37)32-24-13-7-4-8-14-24)29-33-28-16-10-9-15-27(28)30(36)34(29)21-23-11-5-3-6-12-23/h3-20,22H,21H2,1-2H3,(H,32,37) |
| InChIKey | OFECOXXGESBFNZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |