About 1-propan-2-yladamantane
1-propan-2-yladamantane (PubChem CID 524483) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 1-propan-2-yladamantane.
Molecular Properties
| Compound Name | 1-propan-2-yladamantane |
| PubChem CID | 524483 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 1-propan-2-yladamantane |
| SMILES | CC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H22/c1-9(2)13-6-10-3-11(7-13)5-12(4-10)8-13/h9-12H,3-8H2,1-2H3 |
| InChIKey | ISDSLPMQFWIUPU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-propan-2-yladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yladamantane?
The IUPAC name of 1-propan-2-yladamantane (CID 524483) is 1-propan-2-yladamantane.
What is the SMILES notation for 1-propan-2-yladamantane?
The canonical SMILES for 1-propan-2-yladamantane is CC(C)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-propan-2-yladamantane?
The InChIKey is ISDSLPMQFWIUPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-9(2)13-6-10-3-11(7-13)5-12(4-10)8-13/h9-12H,3-8H2,1-2H3.
What are the key properties of 1-propan-2-yladamantane?
1-propan-2-yladamantane has a molecular weight of 178.32 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yladamantane is sourced from PubChem (CID 524483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).