About 3-methyl-2,3-dihydro-1H-indole
3-methyl-2,3-dihydro-1H-indole (PubChem CID 524504) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 3-methyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-methyl-2,3-dihydro-1H-indole |
| PubChem CID | 524504 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 3-methyl-2,3-dihydro-1H-indole |
| SMILES | CC1CNc2ccccc21 |
| InChI | InChI=1S/C9H11N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-5,7,10H,6H2,1H3 |
| InChIKey | BFQARNDIMKOOQQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,3-dihydro-1H-indole?
The IUPAC name of 3-methyl-2,3-dihydro-1H-indole (CID 524504) is 3-methyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 3-methyl-2,3-dihydro-1H-indole?
The canonical SMILES for 3-methyl-2,3-dihydro-1H-indole is CC1CNc2ccccc21.
What is the InChIKey of 3-methyl-2,3-dihydro-1H-indole?
The InChIKey is BFQARNDIMKOOQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-5,7,10H,6H2,1H3.
What are the key properties of 3-methyl-2,3-dihydro-1H-indole?
3-methyl-2,3-dihydro-1H-indole has a molecular weight of 133.19 g/mol, XLogP of 2.22, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 524504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).