C25H16ClN3O6S — CID 5245150
1-(6-chloro-1,3-benzothiazol-2-yl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 5245150) has the molecular formula C25H16ClN3O6S and a molecular weight of 521.94 g/mol. Its IUPAC name is 1-(6-chloro-1,3-benzothiazol-2-yl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5245150 |
| Molecular Formula | C25H16ClN3O6S |
| Molecular Weight | 521.94 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C(O)=C2C(=O)C(=O)N(c3nc4ccc(Cl)cc4s3)C2c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C25H16ClN3O6S/c1-35-17-4-2-3-14(11-17)22(30)20-21(13-5-8-16(9-6-13)29(33)34)28(24(32)23(20)31)25-27-18-10-7-15(26)12-19(18)36-25/h2-12,21,30H,1H3 |
| InChIKey | LBGOPBMKBLDXJO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.94 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|