C9H17N — CID 524516
1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole (PubChem CID 524516) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is 1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole.
| Compound Name | 1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole |
|---|---|
| PubChem CID | 524516 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole |
| SMILES | CN1CCC2CCCCC21 |
| InChI | InChI=1S/C9H17N/c1-10-7-6-8-4-2-3-5-9(8)10/h8-9H,2-7H2,1H3 |
| InChIKey | AWTMNUUIQAMREG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |