About 1-propyl-2,3-dihydroindole
1-propyl-2,3-dihydroindole (PubChem CID 524518) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 1-propyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-propyl-2,3-dihydroindole |
| PubChem CID | 524518 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1-propyl-2,3-dihydroindole |
| SMILES | CCCN1CCc2ccccc21 |
| InChI | InChI=1S/C11H15N/c1-2-8-12-9-7-10-5-3-4-6-11(10)12/h3-6H,2,7-9H2,1H3 |
| InChIKey | MCXCFRRVMJIYPS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-propyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-2,3-dihydroindole?
The IUPAC name of 1-propyl-2,3-dihydroindole (CID 524518) is 1-propyl-2,3-dihydroindole.
What is the SMILES notation for 1-propyl-2,3-dihydroindole?
The canonical SMILES for 1-propyl-2,3-dihydroindole is CCCN1CCc2ccccc21.
What is the InChIKey of 1-propyl-2,3-dihydroindole?
The InChIKey is MCXCFRRVMJIYPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-2-8-12-9-7-10-5-3-4-6-11(10)12/h3-6H,2,7-9H2,1H3.
What are the key properties of 1-propyl-2,3-dihydroindole?
1-propyl-2,3-dihydroindole has a molecular weight of 161.25 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-2,3-dihydroindole is sourced from PubChem (CID 524518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).